C19H24N2O — CID 18144066
1-methyl-3-[2-(2-methylphenyl)ethyl]-1-(1-phenylethyl)urea (PubChem CID 18144066) has the molecular formula C19H24N2O and a molecular weight of 296.41 g/mol. Its IUPAC name is 1-methyl-3-[2-(2-methylphenyl)ethyl]-1-(1-phenylethyl)urea.
| Compound Name | 1-methyl-3-[2-(2-methylphenyl)ethyl]-1-(1-phenylethyl)urea |
|---|---|
| PubChem CID | 18144066 |
| Molecular Formula | C19H24N2O |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.19 |
| IUPAC Name | 1-methyl-3-[2-(2-methylphenyl)ethyl]-1-(1-phenylethyl)urea |
| SMILES | Cc1ccccc1CCNC(=O)N(C)C(C)c1ccccc1 |
| InChI | InChI=1S/C19H24N2O/c1-15-9-7-8-10-17(15)13-14-20-19(22)21(3)16(2)18-11-5-4-6-12-18/h4-12,16H,13-14H2,1-3H3,(H,20,22) |
| InChIKey | YNPNHEWJZYIADA-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |