C15H20Cl2N2O4 — CID 122013713
4-[[1-(3,4-dichlorophenyl)-3-methoxypropyl]carbamoylamino]butanoic acid (PubChem CID 122013713) has the molecular formula C15H20Cl2N2O4 and a molecular weight of 363.24 g/mol. Its IUPAC name is 4-[[1-(3,4-dichlorophenyl)-3-methoxypropyl]carbamoylamino]butanoic acid.
| Compound Name | 4-[[1-(3,4-dichlorophenyl)-3-methoxypropyl]carbamoylamino]butanoic acid |
|---|---|
| PubChem CID | 122013713 |
| Molecular Formula | C15H20Cl2N2O4 |
| Molecular Weight | 363.24 g/mol |
| Exact Mass | 362.08 |
| IUPAC Name | 4-[[1-(3,4-dichlorophenyl)-3-methoxypropyl]carbamoylamino]butanoic acid |
| SMILES | COCCC(NC(=O)NCCCC(=O)O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H20Cl2N2O4/c1-23-8-6-13(10-4-5-11(16)12(17)9-10)19-15(22)18-7-2-3-14(20)21/h4-5,9,13H,2-3,6-8H2,1H3,(H,20,21)(H2,18,19,22) |
| InChIKey | GHDOLGLBLZZZFV-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.24 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|