C18H21N3O3 — CID 122012499
4-[[(4-methylphenyl)-pyridin-2-ylmethyl]carbamoylamino]butanoic acid (PubChem CID 122012499) has the molecular formula C18H21N3O3 and a molecular weight of 327.38 g/mol. Its IUPAC name is 4-[[(4-methylphenyl)-pyridin-2-ylmethyl]carbamoylamino]butanoic acid.
| Compound Name | 4-[[(4-methylphenyl)-pyridin-2-ylmethyl]carbamoylamino]butanoic acid |
|---|---|
| PubChem CID | 122012499 |
| Molecular Formula | C18H21N3O3 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | 4-[[(4-methylphenyl)-pyridin-2-ylmethyl]carbamoylamino]butanoic acid |
| SMILES | Cc1ccc(C(NC(=O)NCCCC(=O)O)c2ccccn2)cc1 |
| InChI | InChI=1S/C18H21N3O3/c1-13-7-9-14(10-8-13)17(15-5-2-3-11-19-15)21-18(24)20-12-4-6-16(22)23/h2-3,5,7-11,17H,4,6,12H2,1H3,(H,22,23)(H2,20,21,24) |
| InChIKey | WBSHBZNNTDWJST-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|