C25H26N4O3 — CID 166219888
1-[2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)ethyl]-3-[(4-methylphenyl)-pyridin-2-ylmethyl]urea (PubChem CID 166219888) has the molecular formula C25H26N4O3 and a molecular weight of 430.51 g/mol. Its IUPAC name is 1-[2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)ethyl]-3-[(4-methylphenyl)-pyridin-2-ylmethyl]urea.
| Compound Name | 1-[2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)ethyl]-3-[(4-methylphenyl)-pyridin-2-ylmethyl]urea |
|---|---|
| PubChem CID | 166219888 |
| Molecular Formula | C25H26N4O3 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | 1-[2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)ethyl]-3-[(4-methylphenyl)-pyridin-2-ylmethyl]urea |
| SMILES | Cc1ccc(C(NC(=O)NCCN2C(=O)C3C4C=CC(C4)C3C2=O)c2ccccn2)cc1 |
| InChI | InChI=1S/C25H26N4O3/c1-15-5-7-16(8-6-15)22(19-4-2-3-11-26-19)28-25(32)27-12-13-29-23(30)20-17-9-10-18(14-17)21(20)24(29)31/h2-11,17-18,20-22H,12-14H2,1H3,(H2,27,28,32) |
| InChIKey | YKLVAEUNYRLZDR-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|