C21H20FN3O — CID 36512687
1-[2-(2-fluorophenyl)ethyl]-3-[(S)-phenyl(pyridin-2-yl)methyl]urea (PubChem CID 36512687) has the molecular formula C21H20FN3O and a molecular weight of 349.41 g/mol. Its IUPAC name is 1-[2-(2-fluorophenyl)ethyl]-3-[(S)-phenyl(pyridin-2-yl)methyl]urea.
| Compound Name | 1-[2-(2-fluorophenyl)ethyl]-3-[(S)-phenyl(pyridin-2-yl)methyl]urea |
|---|---|
| PubChem CID | 36512687 |
| Molecular Formula | C21H20FN3O |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | 1-[2-(2-fluorophenyl)ethyl]-3-[(S)-phenyl(pyridin-2-yl)methyl]urea |
| SMILES | O=C(NCCc1ccccc1F)N[C@@H](c1ccccc1)c1ccccn1 |
| InChI | InChI=1S/C21H20FN3O/c22-18-11-5-4-8-16(18)13-15-24-21(26)25-20(17-9-2-1-3-10-17)19-12-6-7-14-23-19/h1-12,14,20H,13,15H2,(H2,24,25,26)/t20-/m0/s1 |
| InChIKey | MBBBQNMKGVFGDP-FQEVSTJZSA-N |
| XLogP | 3.85 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |