C17H22FN3O3 — CID 122014966
1-[[1-(2-fluorophenyl)pyrrolidin-3-yl]methylcarbamoyl]pyrrolidine-3-carboxylic acid (PubChem CID 122014966) has the molecular formula C17H22FN3O3 and a molecular weight of 335.38 g/mol. Its IUPAC name is 1-[[1-(2-fluorophenyl)pyrrolidin-3-yl]methylcarbamoyl]pyrrolidine-3-carboxylic acid.
| Compound Name | 1-[[1-(2-fluorophenyl)pyrrolidin-3-yl]methylcarbamoyl]pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122014966 |
| Molecular Formula | C17H22FN3O3 |
| Molecular Weight | 335.38 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | 1-[[1-(2-fluorophenyl)pyrrolidin-3-yl]methylcarbamoyl]pyrrolidine-3-carboxylic acid |
| SMILES | O=C(O)C1CCN(C(=O)NCC2CCN(c3ccccc3F)C2)C1 |
| InChI | InChI=1S/C17H22FN3O3/c18-14-3-1-2-4-15(14)20-7-5-12(10-20)9-19-17(24)21-8-6-13(11-21)16(22)23/h1-4,12-13H,5-11H2,(H,19,24)(H,22,23) |
| InChIKey | QZXMBJVFCZYQLK-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.38 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |