C16H22FN3O3 — CID 122014965
4-[[1-(2-fluorophenyl)pyrrolidin-3-yl]methylcarbamoylamino]butanoic acid (PubChem CID 122014965) has the molecular formula C16H22FN3O3 and a molecular weight of 323.37 g/mol. Its IUPAC name is 4-[[1-(2-fluorophenyl)pyrrolidin-3-yl]methylcarbamoylamino]butanoic acid.
| Compound Name | 4-[[1-(2-fluorophenyl)pyrrolidin-3-yl]methylcarbamoylamino]butanoic acid |
|---|---|
| PubChem CID | 122014965 |
| Molecular Formula | C16H22FN3O3 |
| Molecular Weight | 323.37 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | 4-[[1-(2-fluorophenyl)pyrrolidin-3-yl]methylcarbamoylamino]butanoic acid |
| SMILES | O=C(O)CCCNC(=O)NCC1CCN(c2ccccc2F)C1 |
| InChI | InChI=1S/C16H22FN3O3/c17-13-4-1-2-5-14(13)20-9-7-12(11-20)10-19-16(23)18-8-3-6-15(21)22/h1-2,4-5,12H,3,6-11H2,(H,21,22)(H2,18,19,23) |
| InChIKey | MYIAXZONIRVQCL-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.37 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|