3-[bis(2,2-dimethylpropyl)carbamoylamino]propanoic acid

C14H28N2O3 — CID 122017989

IUPAC3-[bis(2,2-dimethylpropyl)carbamoylamino]propanoic acid
SMILESCC(C)(C)CN(CC(C)(C)C)C(=O)NCCC(=O)O
InChIInChI=1S/C14H28N2O3/c1-13(2,3)9-16(10-14(4,5)6)12(19)15-8-7-11(17)18/h7-10H2,1-6H3,(H,15,19)(H,17,18)
InChIKeyLEBMMZJFWYZCGC-UHFFFAOYSA-N
MW272.39 g/mol
LogP2.56
Rot. Bonds5

About 3-[bis(2,2-dimethylpropyl)carbamoylamino]propanoic acid

3-[bis(2,2-dimethylpropyl)carbamoylamino]propanoic acid (PubChem CID 122017989) has the molecular formula C14H28N2O3 and a molecular weight of 272.39 g/mol. Its IUPAC name is 3-[bis(2,2-dimethylpropyl)carbamoylamino]propanoic acid.

Molecular Properties

Compound Name3-[bis(2,2-dimethylpropyl)carbamoylamino]propanoic acid
PubChem CID122017989
Molecular FormulaC14H28N2O3
Molecular Weight272.39 g/mol
Exact Mass272.21
IUPAC Name3-[bis(2,2-dimethylpropyl)carbamoylamino]propanoic acid
SMILESCC(C)(C)CN(CC(C)(C)C)C(=O)NCCC(=O)O
InChIInChI=1S/C14H28N2O3/c1-13(2,3)9-16(10-14(4,5)6)12(19)15-8-7-11(17)18/h7-10H2,1-6H3,(H,15,19)(H,17,18)
InChIKeyLEBMMZJFWYZCGC-UHFFFAOYSA-N
XLogP2.56
TPSA69.64 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500272.39
LogP ≤ 52.56
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 3-[bis(2,2-dimethylpropyl)carbamoylamino]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[bis(2,2-dimethylpropyl)carbamoylamino]propanoic acid?
The IUPAC name of 3-[bis(2,2-dimethylpropyl)carbamoylamino]propanoic acid (CID 122017989) is 3-[bis(2,2-dimethylpropyl)carbamoylamino]propanoic acid.
What is the SMILES notation for 3-[bis(2,2-dimethylpropyl)carbamoylamino]propanoic acid?
The canonical SMILES for 3-[bis(2,2-dimethylpropyl)carbamoylamino]propanoic acid is CC(C)(C)CN(CC(C)(C)C)C(=O)NCCC(=O)O.
What is the InChIKey of 3-[bis(2,2-dimethylpropyl)carbamoylamino]propanoic acid?
The InChIKey is LEBMMZJFWYZCGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28N2O3/c1-13(2,3)9-16(10-14(4,5)6)12(19)15-8-7-11(17)18/h7-10H2,1-6H3,(H,15,19)(H,17,18).
What are the key properties of 3-[bis(2,2-dimethylpropyl)carbamoylamino]propanoic acid?
3-[bis(2,2-dimethylpropyl)carbamoylamino]propanoic acid has a molecular weight of 272.39 g/mol, XLogP of 2.56, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[bis(2,2-dimethylpropyl)carbamoylamino]propanoic acid is sourced from PubChem (CID 122017989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).