C8H16N2O3 — CID 61195850
3-[[methyl(propyl)carbamoyl]amino]propanoic acid (PubChem CID 61195850) has the molecular formula C8H16N2O3 and a molecular weight of 188.23 g/mol. Its IUPAC name is 3-[[methyl(propyl)carbamoyl]amino]propanoic acid.
| Compound Name | 3-[[methyl(propyl)carbamoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 61195850 |
| Molecular Formula | C8H16N2O3 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.12 |
| IUPAC Name | 3-[[methyl(propyl)carbamoyl]amino]propanoic acid |
| SMILES | CCCN(C)C(=O)NCCC(=O)O |
| InChI | InChI=1S/C8H16N2O3/c1-3-6-10(2)8(13)9-5-4-7(11)12/h3-6H2,1-2H3,(H,9,13)(H,11,12) |
| InChIKey | UDYFBAIWIMOGHR-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |