C9H18N2O4 — CID 62997589
3-[[3-methoxypropyl(methyl)carbamoyl]amino]propanoic acid (PubChem CID 62997589) has the molecular formula C9H18N2O4 and a molecular weight of 218.25 g/mol. Its IUPAC name is 3-[[3-methoxypropyl(methyl)carbamoyl]amino]propanoic acid.
| Compound Name | 3-[[3-methoxypropyl(methyl)carbamoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 62997589 |
| Molecular Formula | C9H18N2O4 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | 3-[[3-methoxypropyl(methyl)carbamoyl]amino]propanoic acid |
| SMILES | COCCCN(C)C(=O)NCCC(=O)O |
| InChI | InChI=1S/C9H18N2O4/c1-11(6-3-7-15-2)9(14)10-5-4-8(12)13/h3-7H2,1-2H3,(H,10,14)(H,12,13) |
| InChIKey | FIFQBOYVPFTPFM-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|