C8H22N2O7P2+2 — CID 88765209
bis(dihydroxy(oxo)phosphanium);1-methyl-1,3-dipropylurea (PubChem CID 88765209) has the molecular formula C8H22N2O7P2+2 and a molecular weight of 320.22 g/mol. Its IUPAC name is bis(dihydroxy(oxo)phosphanium);1-methyl-1,3-dipropylurea.
| Compound Name | bis(dihydroxy(oxo)phosphanium);1-methyl-1,3-dipropylurea |
|---|---|
| PubChem CID | 88765209 |
| Molecular Formula | C8H22N2O7P2+2 |
| Molecular Weight | 320.22 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | bis(dihydroxy(oxo)phosphanium);1-methyl-1,3-dipropylurea |
| SMILES | CCCNC(=O)N(C)CCC.O=[P+](O)O.O=[P+](O)O |
| InChI | InChI=1S/C8H18N2O.2HO3P/c1-4-6-9-8(11)10(3)7-5-2;2*1-4(2)3/h4-7H2,1-3H3,(H,9,11);2*(H-,1,2,3)/p+2 |
| InChIKey | IEKJJYKKMILGRC-UHFFFAOYSA-P |
| XLogP | 0.70 |
| TPSA | 147.40 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.22 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|