C17H20N4O3 — CID 122019610
4-[[[4-(1H-imidazol-2-yl)piperidine-1-carbonyl]amino]methyl]benzoic acid (PubChem CID 122019610) has the molecular formula C17H20N4O3 and a molecular weight of 328.37 g/mol. Its IUPAC name is 4-[[[4-(1H-imidazol-2-yl)piperidine-1-carbonyl]amino]methyl]benzoic acid.
| Compound Name | 4-[[[4-(1H-imidazol-2-yl)piperidine-1-carbonyl]amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 122019610 |
| Molecular Formula | C17H20N4O3 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | 4-[[[4-(1H-imidazol-2-yl)piperidine-1-carbonyl]amino]methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CNC(=O)N2CCC(c3ncc[nH]3)CC2)cc1 |
| InChI | InChI=1S/C17H20N4O3/c22-16(23)14-3-1-12(2-4-14)11-20-17(24)21-9-5-13(6-10-21)15-18-7-8-19-15/h1-4,7-8,13H,5-6,9-11H2,(H,18,19)(H,20,24)(H,22,23) |
| InChIKey | YDMNXHKUPGJIIS-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 98.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |