C13H17N3O3 — CID 61405049
4-[(piperazine-1-carbonylamino)methyl]benzoic acid (PubChem CID 61405049) has the molecular formula C13H17N3O3 and a molecular weight of 263.30 g/mol. Its IUPAC name is 4-[(piperazine-1-carbonylamino)methyl]benzoic acid.
| Compound Name | 4-[(piperazine-1-carbonylamino)methyl]benzoic acid |
|---|---|
| PubChem CID | 61405049 |
| Molecular Formula | C13H17N3O3 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | 4-[(piperazine-1-carbonylamino)methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CNC(=O)N2CCNCC2)cc1 |
| InChI | InChI=1S/C13H17N3O3/c17-12(18)11-3-1-10(2-4-11)9-15-13(19)16-7-5-14-6-8-16/h1-4,14H,5-9H2,(H,15,19)(H,17,18) |
| InChIKey | IDVLGXSFIWJEMF-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |