C20H29N3O4 — CID 122019649
4-[[[3-(pentan-2-ylcarbamoyl)piperidine-1-carbonyl]amino]methyl]benzoic acid (PubChem CID 122019649) has the molecular formula C20H29N3O4 and a molecular weight of 375.47 g/mol. Its IUPAC name is 4-[[[3-(pentan-2-ylcarbamoyl)piperidine-1-carbonyl]amino]methyl]benzoic acid.
| Compound Name | 4-[[[3-(pentan-2-ylcarbamoyl)piperidine-1-carbonyl]amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 122019649 |
| Molecular Formula | C20H29N3O4 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.22 |
| IUPAC Name | 4-[[[3-(pentan-2-ylcarbamoyl)piperidine-1-carbonyl]amino]methyl]benzoic acid |
| SMILES | CCCC(C)NC(=O)C1CCCN(C(=O)NCc2ccc(C(=O)O)cc2)C1 |
| InChI | InChI=1S/C20H29N3O4/c1-3-5-14(2)22-18(24)17-6-4-11-23(13-17)20(27)21-12-15-7-9-16(10-8-15)19(25)26/h7-10,14,17H,3-6,11-13H2,1-2H3,(H,21,27)(H,22,24)(H,25,26) |
| InChIKey | FGSPSBKOGMMNPD-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |