C19H21FN2O3 — CID 122019912
4-[[[1-(3-fluorophenyl)propan-2-yl-methylcarbamoyl]amino]methyl]benzoic acid (PubChem CID 122019912) has the molecular formula C19H21FN2O3 and a molecular weight of 344.39 g/mol. Its IUPAC name is 4-[[[1-(3-fluorophenyl)propan-2-yl-methylcarbamoyl]amino]methyl]benzoic acid.
| Compound Name | 4-[[[1-(3-fluorophenyl)propan-2-yl-methylcarbamoyl]amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 122019912 |
| Molecular Formula | C19H21FN2O3 |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | 4-[[[1-(3-fluorophenyl)propan-2-yl-methylcarbamoyl]amino]methyl]benzoic acid |
| SMILES | CC(Cc1cccc(F)c1)N(C)C(=O)NCc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C19H21FN2O3/c1-13(10-15-4-3-5-17(20)11-15)22(2)19(25)21-12-14-6-8-16(9-7-14)18(23)24/h3-9,11,13H,10,12H2,1-2H3,(H,21,25)(H,23,24) |
| InChIKey | ZYNAAPIHXBEUQN-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |