C13H18N2O4 — CID 122020463
4-[[[[(2R)-1-hydroxypropan-2-yl]-methylcarbamoyl]amino]methyl]benzoic acid (PubChem CID 122020463) has the molecular formula C13H18N2O4 and a molecular weight of 266.30 g/mol. Its IUPAC name is 4-[[[[(2R)-1-hydroxypropan-2-yl]-methylcarbamoyl]amino]methyl]benzoic acid.
| Compound Name | 4-[[[[(2R)-1-hydroxypropan-2-yl]-methylcarbamoyl]amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 122020463 |
| Molecular Formula | C13H18N2O4 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | 4-[[[[(2R)-1-hydroxypropan-2-yl]-methylcarbamoyl]amino]methyl]benzoic acid |
| SMILES | C[C@H](CO)N(C)C(=O)NCc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C13H18N2O4/c1-9(8-16)15(2)13(19)14-7-10-3-5-11(6-4-10)12(17)18/h3-6,9,16H,7-8H2,1-2H3,(H,14,19)(H,17,18)/t9-/m1/s1 |
| InChIKey | PBUZIWMISNCSCJ-SECBINFHSA-N |
| XLogP | 0.91 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |