C18H19F3N4O3 — CID 122020851
4-[[[3-[3-(trifluoromethyl)pyrazol-1-yl]piperidine-1-carbonyl]amino]methyl]benzoic acid (PubChem CID 122020851) has the molecular formula C18H19F3N4O3 and a molecular weight of 396.37 g/mol. Its IUPAC name is 4-[[[3-[3-(trifluoromethyl)pyrazol-1-yl]piperidine-1-carbonyl]amino]methyl]benzoic acid.
| Compound Name | 4-[[[3-[3-(trifluoromethyl)pyrazol-1-yl]piperidine-1-carbonyl]amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 122020851 |
| Molecular Formula | C18H19F3N4O3 |
| Molecular Weight | 396.37 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | 4-[[[3-[3-(trifluoromethyl)pyrazol-1-yl]piperidine-1-carbonyl]amino]methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CNC(=O)N2CCCC(n3ccc(C(F)(F)F)n3)C2)cc1 |
| InChI | InChI=1S/C18H19F3N4O3/c19-18(20,21)15-7-9-25(23-15)14-2-1-8-24(11-14)17(28)22-10-12-3-5-13(6-4-12)16(26)27/h3-7,9,14H,1-2,8,10-11H2,(H,22,28)(H,26,27) |
| InChIKey | PYEJDTJMXKWNML-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.37 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |