C17H24N4O4 — CID 122021540
4-[[3-[(5-methyl-2-pyridinyl)carbamoyl]piperidine-1-carbonyl]amino]butanoic acid (PubChem CID 122021540) has the molecular formula C17H24N4O4 and a molecular weight of 348.40 g/mol. Its IUPAC name is 4-[[3-[(5-methyl-2-pyridinyl)carbamoyl]piperidine-1-carbonyl]amino]butanoic acid.
| Compound Name | 4-[[3-[(5-methyl-2-pyridinyl)carbamoyl]piperidine-1-carbonyl]amino]butanoic acid |
|---|---|
| PubChem CID | 122021540 |
| Molecular Formula | C17H24N4O4 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | 4-[[3-[(5-methyl-2-pyridinyl)carbamoyl]piperidine-1-carbonyl]amino]butanoic acid |
| SMILES | Cc1ccc(NC(=O)C2CCCN(C(=O)NCCCC(=O)O)C2)nc1 |
| InChI | InChI=1S/C17H24N4O4/c1-12-6-7-14(19-10-12)20-16(24)13-4-3-9-21(11-13)17(25)18-8-2-5-15(22)23/h6-7,10,13H,2-5,8-9,11H2,1H3,(H,18,25)(H,22,23)(H,19,20,24) |
| InChIKey | QPYCIGBIHBKEEZ-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 111.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|