C17H22F2N2O3 — CID 122021856
4-[[4-[(2,3-difluorophenyl)methyl]piperidine-1-carbonyl]amino]butanoic acid (PubChem CID 122021856) has the molecular formula C17H22F2N2O3 and a molecular weight of 340.37 g/mol. Its IUPAC name is 4-[[4-[(2,3-difluorophenyl)methyl]piperidine-1-carbonyl]amino]butanoic acid.
| Compound Name | 4-[[4-[(2,3-difluorophenyl)methyl]piperidine-1-carbonyl]amino]butanoic acid |
|---|---|
| PubChem CID | 122021856 |
| Molecular Formula | C17H22F2N2O3 |
| Molecular Weight | 340.37 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | 4-[[4-[(2,3-difluorophenyl)methyl]piperidine-1-carbonyl]amino]butanoic acid |
| SMILES | O=C(O)CCCNC(=O)N1CCC(Cc2cccc(F)c2F)CC1 |
| InChI | InChI=1S/C17H22F2N2O3/c18-14-4-1-3-13(16(14)19)11-12-6-9-21(10-7-12)17(24)20-8-2-5-15(22)23/h1,3-4,12H,2,5-11H2,(H,20,24)(H,22,23) |
| InChIKey | CMAASJPCLPRWLF-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.37 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|