C17H24N2O3 — CID 122021925
4-[(2,5-dimethyl-3-phenylpyrrolidine-1-carbonyl)amino]butanoic acid (PubChem CID 122021925) has the molecular formula C17H24N2O3 and a molecular weight of 304.39 g/mol. Its IUPAC name is 4-[(2,5-dimethyl-3-phenylpyrrolidine-1-carbonyl)amino]butanoic acid.
| Compound Name | 4-[(2,5-dimethyl-3-phenylpyrrolidine-1-carbonyl)amino]butanoic acid |
|---|---|
| PubChem CID | 122021925 |
| Molecular Formula | C17H24N2O3 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | 4-[(2,5-dimethyl-3-phenylpyrrolidine-1-carbonyl)amino]butanoic acid |
| SMILES | CC1CC(c2ccccc2)C(C)N1C(=O)NCCCC(=O)O |
| InChI | InChI=1S/C17H24N2O3/c1-12-11-15(14-7-4-3-5-8-14)13(2)19(12)17(22)18-10-6-9-16(20)21/h3-5,7-8,12-13,15H,6,9-11H2,1-2H3,(H,18,22)(H,20,21) |
| InChIKey | JDDGBKZCNRLACT-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|