C17H24N2O5 — CID 122023538
4-[[2-hydroxy-2-(3-methoxyphenyl)ethyl]carbamoylamino]cyclohexane-1-carboxylic acid (PubChem CID 122023538) has the molecular formula C17H24N2O5 and a molecular weight of 336.39 g/mol. Its IUPAC name is 4-[[2-hydroxy-2-(3-methoxyphenyl)ethyl]carbamoylamino]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[[2-hydroxy-2-(3-methoxyphenyl)ethyl]carbamoylamino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 122023538 |
| Molecular Formula | C17H24N2O5 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | 4-[[2-hydroxy-2-(3-methoxyphenyl)ethyl]carbamoylamino]cyclohexane-1-carboxylic acid |
| SMILES | COc1cccc(C(O)CNC(=O)NC2CCC(C(=O)O)CC2)c1 |
| InChI | InChI=1S/C17H24N2O5/c1-24-14-4-2-3-12(9-14)15(20)10-18-17(23)19-13-7-5-11(6-8-13)16(21)22/h2-4,9,11,13,15,20H,5-8,10H2,1H3,(H,21,22)(H2,18,19,23) |
| InChIKey | FJQNZLKCBBZQGP-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |