C21H26N2O4 — CID 119061128
1-(4-hydroxycyclohexyl)-3-[2-hydroxy-2-(3-phenoxyphenyl)ethyl]urea (PubChem CID 119061128) has the molecular formula C21H26N2O4 and a molecular weight of 370.45 g/mol. Its IUPAC name is 1-(4-hydroxycyclohexyl)-3-[2-hydroxy-2-(3-phenoxyphenyl)ethyl]urea.
| Compound Name | 1-(4-hydroxycyclohexyl)-3-[2-hydroxy-2-(3-phenoxyphenyl)ethyl]urea |
|---|---|
| PubChem CID | 119061128 |
| Molecular Formula | C21H26N2O4 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | 1-(4-hydroxycyclohexyl)-3-[2-hydroxy-2-(3-phenoxyphenyl)ethyl]urea |
| SMILES | O=C(NCC(O)c1cccc(Oc2ccccc2)c1)NC1CCC(O)CC1 |
| InChI | InChI=1S/C21H26N2O4/c24-17-11-9-16(10-12-17)23-21(26)22-14-20(25)15-5-4-8-19(13-15)27-18-6-2-1-3-7-18/h1-8,13,16-17,20,24-25H,9-12,14H2,(H2,22,23,26) |
| InChIKey | GWQSWNKEOWUDOL-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 90.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |