C21H30N2O4 — CID 122023957
4-[[2-(2-methoxyphenyl)-5-methylpiperidine-1-carbonyl]amino]cyclohexane-1-carboxylic acid (PubChem CID 122023957) has the molecular formula C21H30N2O4 and a molecular weight of 374.48 g/mol. Its IUPAC name is 4-[[2-(2-methoxyphenyl)-5-methylpiperidine-1-carbonyl]amino]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[[2-(2-methoxyphenyl)-5-methylpiperidine-1-carbonyl]amino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 122023957 |
| Molecular Formula | C21H30N2O4 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.22 |
| IUPAC Name | 4-[[2-(2-methoxyphenyl)-5-methylpiperidine-1-carbonyl]amino]cyclohexane-1-carboxylic acid |
| SMILES | COc1ccccc1C1CCC(C)CN1C(=O)NC1CCC(C(=O)O)CC1 |
| InChI | InChI=1S/C21H30N2O4/c1-14-7-12-18(17-5-3-4-6-19(17)27-2)23(13-14)21(26)22-16-10-8-15(9-11-16)20(24)25/h3-6,14-16,18H,7-13H2,1-2H3,(H,22,26)(H,24,25) |
| InChIKey | ZEIWISQBRBOQQG-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |