C19H33N3O3 — CID 122025505
2-[[3-[[cyclohexylmethyl(prop-2-enyl)carbamoyl]amino]cyclobutyl]-ethylamino]acetic acid (PubChem CID 122025505) has the molecular formula C19H33N3O3 and a molecular weight of 351.49 g/mol. Its IUPAC name is 2-[[3-[[cyclohexylmethyl(prop-2-enyl)carbamoyl]amino]cyclobutyl]-ethylamino]acetic acid.
| Compound Name | 2-[[3-[[cyclohexylmethyl(prop-2-enyl)carbamoyl]amino]cyclobutyl]-ethylamino]acetic acid |
|---|---|
| PubChem CID | 122025505 |
| Molecular Formula | C19H33N3O3 |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.25 |
| IUPAC Name | 2-[[3-[[cyclohexylmethyl(prop-2-enyl)carbamoyl]amino]cyclobutyl]-ethylamino]acetic acid |
| SMILES | C=CCN(CC1CCCCC1)C(=O)NC1CC(N(CC)CC(=O)O)C1 |
| InChI | InChI=1S/C19H33N3O3/c1-3-10-22(13-15-8-6-5-7-9-15)19(25)20-16-11-17(12-16)21(4-2)14-18(23)24/h3,15-17H,1,4-14H2,2H3,(H,20,25)(H,23,24) |
| InChIKey | JUBZKLAXNLYAPC-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|