C20H30N2O4 — CID 122027615
4-[[3-(hydroxymethyl)-3-propylpyrrolidine-1-carbonyl]amino]-5-phenylpentanoic acid (PubChem CID 122027615) has the molecular formula C20H30N2O4 and a molecular weight of 362.47 g/mol. Its IUPAC name is 4-[[3-(hydroxymethyl)-3-propylpyrrolidine-1-carbonyl]amino]-5-phenylpentanoic acid.
| Compound Name | 4-[[3-(hydroxymethyl)-3-propylpyrrolidine-1-carbonyl]amino]-5-phenylpentanoic acid |
|---|---|
| PubChem CID | 122027615 |
| Molecular Formula | C20H30N2O4 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.22 |
| IUPAC Name | 4-[[3-(hydroxymethyl)-3-propylpyrrolidine-1-carbonyl]amino]-5-phenylpentanoic acid |
| SMILES | CCCC1(CO)CCN(C(=O)NC(CCC(=O)O)Cc2ccccc2)C1 |
| InChI | InChI=1S/C20H30N2O4/c1-2-10-20(15-23)11-12-22(14-20)19(26)21-17(8-9-18(24)25)13-16-6-4-3-5-7-16/h3-7,17,23H,2,8-15H2,1H3,(H,21,26)(H,24,25) |
| InChIKey | LRKPTCUVLHDZBE-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |