C18H26N2O3S — CID 122027990
4-[(7-methyl-1,4-thiazepane-4-carbonyl)amino]-5-phenylpentanoic acid (PubChem CID 122027990) has the molecular formula C18H26N2O3S and a molecular weight of 350.48 g/mol. Its IUPAC name is 4-[(7-methyl-1,4-thiazepane-4-carbonyl)amino]-5-phenylpentanoic acid.
| Compound Name | 4-[(7-methyl-1,4-thiazepane-4-carbonyl)amino]-5-phenylpentanoic acid |
|---|---|
| PubChem CID | 122027990 |
| Molecular Formula | C18H26N2O3S |
| Molecular Weight | 350.48 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | 4-[(7-methyl-1,4-thiazepane-4-carbonyl)amino]-5-phenylpentanoic acid |
| SMILES | CC1CCN(C(=O)NC(CCC(=O)O)Cc2ccccc2)CCS1 |
| InChI | InChI=1S/C18H26N2O3S/c1-14-9-10-20(11-12-24-14)18(23)19-16(7-8-17(21)22)13-15-5-3-2-4-6-15/h2-6,14,16H,7-13H2,1H3,(H,19,23)(H,21,22) |
| InChIKey | HFNATDCMVFEUNM-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.48 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |