C21H27N5O3 — CID 122028325
5-phenyl-4-[[4-(pyridazin-3-ylamino)piperidine-1-carbonyl]amino]pentanoic acid (PubChem CID 122028325) has the molecular formula C21H27N5O3 and a molecular weight of 397.48 g/mol. Its IUPAC name is 5-phenyl-4-[[4-(pyridazin-3-ylamino)piperidine-1-carbonyl]amino]pentanoic acid.
| Compound Name | 5-phenyl-4-[[4-(pyridazin-3-ylamino)piperidine-1-carbonyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 122028325 |
| Molecular Formula | C21H27N5O3 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.21 |
| IUPAC Name | 5-phenyl-4-[[4-(pyridazin-3-ylamino)piperidine-1-carbonyl]amino]pentanoic acid |
| SMILES | O=C(O)CCC(Cc1ccccc1)NC(=O)N1CCC(Nc2cccnn2)CC1 |
| InChI | InChI=1S/C21H27N5O3/c27-20(28)9-8-18(15-16-5-2-1-3-6-16)24-21(29)26-13-10-17(11-14-26)23-19-7-4-12-22-25-19/h1-7,12,17-18H,8-11,13-15H2,(H,23,25)(H,24,29)(H,27,28) |
| InChIKey | CLUFSNFQZXQNAE-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 107.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |