C20H27N5O3 — CID 122028268
5-phenyl-4-[[4-(triazol-1-ylmethyl)piperidine-1-carbonyl]amino]pentanoic acid (PubChem CID 122028268) has the molecular formula C20H27N5O3 and a molecular weight of 385.47 g/mol. Its IUPAC name is 5-phenyl-4-[[4-(triazol-1-ylmethyl)piperidine-1-carbonyl]amino]pentanoic acid.
| Compound Name | 5-phenyl-4-[[4-(triazol-1-ylmethyl)piperidine-1-carbonyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 122028268 |
| Molecular Formula | C20H27N5O3 |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.21 |
| IUPAC Name | 5-phenyl-4-[[4-(triazol-1-ylmethyl)piperidine-1-carbonyl]amino]pentanoic acid |
| SMILES | O=C(O)CCC(Cc1ccccc1)NC(=O)N1CCC(Cn2ccnn2)CC1 |
| InChI | InChI=1S/C20H27N5O3/c26-19(27)7-6-18(14-16-4-2-1-3-5-16)22-20(28)24-11-8-17(9-12-24)15-25-13-10-21-23-25/h1-5,10,13,17-18H,6-9,11-12,14-15H2,(H,22,28)(H,26,27) |
| InChIKey | LJSFCADTEPXMBE-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 100.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |