C18H23NO4 — CID 122028438
3-[(2-methoxycarbonyl-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)methyl]benzoic acid (PubChem CID 122028438) has the molecular formula C18H23NO4 and a molecular weight of 317.38 g/mol. Its IUPAC name is 3-[(2-methoxycarbonyl-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)methyl]benzoic acid.
| Compound Name | 3-[(2-methoxycarbonyl-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)methyl]benzoic acid |
|---|---|
| PubChem CID | 122028438 |
| Molecular Formula | C18H23NO4 |
| Molecular Weight | 317.38 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | 3-[(2-methoxycarbonyl-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)methyl]benzoic acid |
| SMILES | COC(=O)C1CC2CCCCC2N1Cc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C18H23NO4/c1-23-18(22)16-10-13-6-2-3-8-15(13)19(16)11-12-5-4-7-14(9-12)17(20)21/h4-5,7,9,13,15-16H,2-3,6,8,10-11H2,1H3,(H,20,21) |
| InChIKey | AKHFDPVMNUUZCZ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.38 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |