C17H24N2O2 — CID 124793095
methyl (2S,3aR,7aR)-1-(2-pyridin-4-ylethyl)-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylate (PubChem CID 124793095) has the molecular formula C17H24N2O2 and a molecular weight of 288.39 g/mol. Its IUPAC name is methyl (2S,3aR,7aR)-1-(2-pyridin-4-ylethyl)-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylate.
| Compound Name | methyl (2S,3aR,7aR)-1-(2-pyridin-4-ylethyl)-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylate |
|---|---|
| PubChem CID | 124793095 |
| Molecular Formula | C17H24N2O2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | methyl (2S,3aR,7aR)-1-(2-pyridin-4-ylethyl)-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylate |
| SMILES | COC(=O)[C@@H]1C[C@H]2CCCC[C@H]2N1CCc1ccncc1 |
| InChI | InChI=1S/C17H24N2O2/c1-21-17(20)16-12-14-4-2-3-5-15(14)19(16)11-8-13-6-9-18-10-7-13/h6-7,9-10,14-16H,2-5,8,11-12H2,1H3/t14-,15-,16+/m1/s1 |
| InChIKey | VPEVHMIDCUVLAH-OAGGEKHMSA-N |
| XLogP | 2.43 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |