C16H22N2O3 — CID 53491400
methyl (2S,3aR,6R,7aR)-6-hydroxy-1-(pyridin-4-ylmethyl)-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylate (PubChem CID 53491400) has the molecular formula C16H22N2O3 and a molecular weight of 290.36 g/mol. Its IUPAC name is methyl (2S,3aR,6R,7aR)-6-hydroxy-1-(pyridin-4-ylmethyl)-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylate.
| Compound Name | methyl (2S,3aR,6R,7aR)-6-hydroxy-1-(pyridin-4-ylmethyl)-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylate |
|---|---|
| PubChem CID | 53491400 |
| Molecular Formula | C16H22N2O3 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | methyl (2S,3aR,6R,7aR)-6-hydroxy-1-(pyridin-4-ylmethyl)-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylate |
| SMILES | COC(=O)[C@@H]1C[C@H]2CC[C@@H](O)C[C@H]2N1Cc1ccncc1 |
| InChI | InChI=1S/C16H22N2O3/c1-21-16(20)15-8-12-2-3-13(19)9-14(12)18(15)10-11-4-6-17-7-5-11/h4-7,12-15,19H,2-3,8-10H2,1H3/t12-,13-,14-,15+/m1/s1 |
| InChIKey | BDTDUXJEWCNKAB-TUVASFSCSA-N |
| XLogP | 1.36 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |