About 5-(pyridin-4-ylmethyl)-5-azatetracyclo[7.2.1.04,11.06,10]dodecane
5-(pyridin-4-ylmethyl)-5-azatetracyclo[7.2.1.04,11.06,10]dodecane (PubChem CID 42630379) has the molecular formula C17H22N2
and a molecular weight of 254.38 g/mol. Its IUPAC name is 5-(pyridin-4-ylmethyl)-5-azatetracyclo[7.2.1.04,11.06,10]dodecane.
Molecular Properties
| Compound Name | 5-(pyridin-4-ylmethyl)-5-azatetracyclo[7.2.1.04,11.06,10]dodecane |
| PubChem CID | 42630379 |
| Molecular Formula | C17H22N2 |
| Molecular Weight | 254.38 g/mol |
| Exact Mass | 254.18 |
| IUPAC Name | 5-(pyridin-4-ylmethyl)-5-azatetracyclo[7.2.1.04,11.06,10]dodecane |
| SMILES | c1cc(CN2C3CCC4CC5CCC2C5C43)ccn1 |
| InChI | InChI=1S/C17H22N2/c1-3-14-16-12(1)9-13-2-4-15(17(13)16)19(14)10-11-5-7-18-8-6-11/h5-8,12-17H,1-4,9-10H2 |
| InChIKey | QVKCYHRINULMAY-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.38 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(pyridin-4-ylmethyl)-5-azatetracyclo[7.2.1.04,11.06,10]dodecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(pyridin-4-ylmethyl)-5-azatetracyclo[7.2.1.04,11.06,10]dodecane?
The IUPAC name of 5-(pyridin-4-ylmethyl)-5-azatetracyclo[7.2.1.04,11.06,10]dodecane (CID 42630379) is 5-(pyridin-4-ylmethyl)-5-azatetracyclo[7.2.1.04,11.06,10]dodecane.
What is the SMILES notation for 5-(pyridin-4-ylmethyl)-5-azatetracyclo[7.2.1.04,11.06,10]dodecane?
The canonical SMILES for 5-(pyridin-4-ylmethyl)-5-azatetracyclo[7.2.1.04,11.06,10]dodecane is c1cc(CN2C3CCC4CC5CCC2C5C43)ccn1.
What is the InChIKey of 5-(pyridin-4-ylmethyl)-5-azatetracyclo[7.2.1.04,11.06,10]dodecane?
The InChIKey is QVKCYHRINULMAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22N2/c1-3-14-16-12(1)9-13-2-4-15(17(13)16)19(14)10-11-5-7-18-8-6-11/h5-8,12-17H,1-4,9-10H2.
What are the key properties of 5-(pyridin-4-ylmethyl)-5-azatetracyclo[7.2.1.04,11.06,10]dodecane?
5-(pyridin-4-ylmethyl)-5-azatetracyclo[7.2.1.04,11.06,10]dodecane has a molecular weight of 254.38 g/mol, XLogP of 3.09, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(pyridin-4-ylmethyl)-5-azatetracyclo[7.2.1.04,11.06,10]dodecane is sourced from PubChem (CID 42630379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).