C15H19N5 — CID 92565932
(2R,6R)-12-methyl-4-(pyridin-4-ylmethyl)-1,4,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-9,11-diene (PubChem CID 92565932) has the molecular formula C15H19N5 and a molecular weight of 269.35 g/mol. Its IUPAC name is (2R,6R)-12-methyl-4-(pyridin-4-ylmethyl)-1,4,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-9,11-diene.
| Compound Name | (2R,6R)-12-methyl-4-(pyridin-4-ylmethyl)-1,4,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-9,11-diene |
|---|---|
| PubChem CID | 92565932 |
| Molecular Formula | C15H19N5 |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | (2R,6R)-12-methyl-4-(pyridin-4-ylmethyl)-1,4,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-9,11-diene |
| SMILES | Cc1nnc2n1[C@H]1CN(Cc3ccncc3)C[C@H]1CC2 |
| InChI | InChI=1S/C15H19N5/c1-11-17-18-15-3-2-13-9-19(10-14(13)20(11)15)8-12-4-6-16-7-5-12/h4-7,13-14H,2-3,8-10H2,1H3/t13-,14+/m1/s1 |
| InChIKey | AKWKCBCZOMLEQD-KGLIPLIRSA-N |
| XLogP | 1.60 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |