C14H18N4S — CID 92565931
(2R,6R)-12-methyl-4-(thiophen-2-ylmethyl)-1,4,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-9,11-diene (PubChem CID 92565931) has the molecular formula C14H18N4S and a molecular weight of 274.39 g/mol. Its IUPAC name is (2R,6R)-12-methyl-4-(thiophen-2-ylmethyl)-1,4,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-9,11-diene.
| Compound Name | (2R,6R)-12-methyl-4-(thiophen-2-ylmethyl)-1,4,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-9,11-diene |
|---|---|
| PubChem CID | 92565931 |
| Molecular Formula | C14H18N4S |
| Molecular Weight | 274.39 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | (2R,6R)-12-methyl-4-(thiophen-2-ylmethyl)-1,4,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-9,11-diene |
| SMILES | Cc1nnc2n1[C@H]1CN(Cc3cccs3)C[C@H]1CC2 |
| InChI | InChI=1S/C14H18N4S/c1-10-15-16-14-5-4-11-7-17(9-13(11)18(10)14)8-12-3-2-6-19-12/h2-3,6,11,13H,4-5,7-9H2,1H3/t11-,13+/m1/s1 |
| InChIKey | PQLQAVDKVYSRTE-YPMHNXCESA-N |
| XLogP | 2.27 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.39 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |