C14H23N3O2S2 — CID 97377229
(3aR,7aS)-N,N-dimethyl-2-(thiophen-2-ylmethyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridine-5-sulfonamide (PubChem CID 97377229) has the molecular formula C14H23N3O2S2 and a molecular weight of 329.49 g/mol. Its IUPAC name is (3aR,7aS)-N,N-dimethyl-2-(thiophen-2-ylmethyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridine-5-sulfonamide.
| Compound Name | (3aR,7aS)-N,N-dimethyl-2-(thiophen-2-ylmethyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridine-5-sulfonamide |
|---|---|
| PubChem CID | 97377229 |
| Molecular Formula | C14H23N3O2S2 |
| Molecular Weight | 329.49 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | (3aR,7aS)-N,N-dimethyl-2-(thiophen-2-ylmethyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridine-5-sulfonamide |
| SMILES | CN(C)S(=O)(=O)N1CC[C@@H]2CN(Cc3cccs3)C[C@@H]2C1 |
| InChI | InChI=1S/C14H23N3O2S2/c1-15(2)21(18,19)17-6-5-12-8-16(9-13(12)10-17)11-14-4-3-7-20-14/h3-4,7,12-13H,5-6,8-11H2,1-2H3/t12-,13-/m1/s1 |
| InChIKey | UFOAZWMWVWNYMK-CHWSQXEVSA-N |
| XLogP | 1.31 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.49 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |