C15H24N2O3S2 — CID 97379834
N-[(4aS,8R,8aS)-6-(thiophen-2-ylmethyl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-8-yl]ethanesulfonamide (PubChem CID 97379834) has the molecular formula C15H24N2O3S2 and a molecular weight of 344.50 g/mol. Its IUPAC name is N-[(4aS,8R,8aS)-6-(thiophen-2-ylmethyl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-8-yl]ethanesulfonamide.
| Compound Name | N-[(4aS,8R,8aS)-6-(thiophen-2-ylmethyl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-8-yl]ethanesulfonamide |
|---|---|
| PubChem CID | 97379834 |
| Molecular Formula | C15H24N2O3S2 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | N-[(4aS,8R,8aS)-6-(thiophen-2-ylmethyl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-8-yl]ethanesulfonamide |
| SMILES | CCS(=O)(=O)N[C@@H]1CN(Cc2cccs2)C[C@@H]2CCCO[C@@H]21 |
| InChI | InChI=1S/C15H24N2O3S2/c1-2-22(18,19)16-14-11-17(10-13-6-4-8-21-13)9-12-5-3-7-20-15(12)14/h4,6,8,12,14-16H,2-3,5,7,9-11H2,1H3/t12-,14+,15-/m0/s1 |
| InChIKey | LHFPNEMSAUPDNQ-CFVMTHIKSA-N |
| XLogP | 1.67 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |