C21H28F6N2O6S — CID 155845227
(4aS,8R,8aS)-8-morpholin-4-yl-6-(thiophen-2-ylmethyl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155845227) has the molecular formula C21H28F6N2O6S and a molecular weight of 550.52 g/mol. Its IUPAC name is (4aS,8R,8aS)-8-morpholin-4-yl-6-(thiophen-2-ylmethyl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | (4aS,8R,8aS)-8-morpholin-4-yl-6-(thiophen-2-ylmethyl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155845227 |
| Molecular Formula | C21H28F6N2O6S |
| Molecular Weight | 550.52 g/mol |
| Exact Mass | 550.16 |
| IUPAC Name | (4aS,8R,8aS)-8-morpholin-4-yl-6-(thiophen-2-ylmethyl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | O=C(O)C(F)(F)F.O=C(O)C(F)(F)F.c1csc(CN2C[C@@H]3CCCO[C@@H]3[C@H](N3CCOCC3)C2)c1 |
| InChI | InChI=1S/C17H26N2O2S.2C2HF3O2/c1-3-14-11-18(12-15-4-2-10-22-15)13-16(17(14)21-7-1)19-5-8-20-9-6-19;2*3-2(4,5)1(6)7/h2,4,10,14,16-17H,1,3,5-9,11-13H2;2*(H,6,7)/t14-,16+,17-;;/m0../s1 |
| InChIKey | HMAOYVDJLKDIKQ-NWPGHJEMSA-N |
| XLogP | 3.33 |
| TPSA | 99.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.52 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |