C20H24F3N3O4S — CID 155863901
N-[(3R,3aR,7aR)-1-(thiophen-2-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-3-yl]-1-methylpyrrole-2-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 155863901) has the molecular formula C20H24F3N3O4S and a molecular weight of 459.49 g/mol. Its IUPAC name is N-[(3R,3aR,7aR)-1-(thiophen-2-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-3-yl]-1-methylpyrrole-2-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[(3R,3aR,7aR)-1-(thiophen-2-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-3-yl]-1-methylpyrrole-2-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155863901 |
| Molecular Formula | C20H24F3N3O4S |
| Molecular Weight | 459.49 g/mol |
| Exact Mass | 459.14 |
| IUPAC Name | N-[(3R,3aR,7aR)-1-(thiophen-2-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-3-yl]-1-methylpyrrole-2-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | Cn1cccc1C(=O)N[C@@H]1CN(Cc2cccs2)[C@@H]2CCCO[C@@H]21.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H23N3O2S.C2HF3O2/c1-20-8-2-6-16(20)18(22)19-14-12-21(11-13-5-4-10-24-13)15-7-3-9-23-17(14)15;3-2(4,5)1(6)7/h2,4-6,8,10,14-15,17H,3,7,9,11-12H2,1H3,(H,19,22);(H,6,7)/t14-,15-,17-;/m1./s1 |
| InChIKey | BHETYSCIKHUJTN-VVXOQCHWSA-N |
| XLogP | 2.88 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.49 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |