C16H21F3N2O4S — CID 155829634
(3aR,6S,7aR)-N-methyl-4-(thiophen-2-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridine-6-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 155829634) has the molecular formula C16H21F3N2O4S and a molecular weight of 394.42 g/mol. Its IUPAC name is (3aR,6S,7aR)-N-methyl-4-(thiophen-2-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridine-6-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | (3aR,6S,7aR)-N-methyl-4-(thiophen-2-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridine-6-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155829634 |
| Molecular Formula | C16H21F3N2O4S |
| Molecular Weight | 394.42 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | (3aR,6S,7aR)-N-methyl-4-(thiophen-2-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridine-6-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | CNC(=O)[C@H]1C[C@H]2OCC[C@H]2N(Cc2cccs2)C1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C14H20N2O2S.C2HF3O2/c1-15-14(17)10-7-13-12(4-5-18-13)16(8-10)9-11-3-2-6-19-11;3-2(4,5)1(6)7/h2-3,6,10,12-13H,4-5,7-9H2,1H3,(H,15,17);(H,6,7)/t10-,12+,13+;/m0./s1 |
| InChIKey | CIEVABYKTIBYCE-JJZGMWGRSA-N |
| XLogP | 2.11 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.42 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |