C22H23F6N5O6 — CID 155827427
(3aR,6S,7aR)-N-pyrazin-2-yl-4-(pyridin-2-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridine-6-carboxamide;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155827427) has the molecular formula C22H23F6N5O6 and a molecular weight of 567.44 g/mol. Its IUPAC name is (3aR,6S,7aR)-N-pyrazin-2-yl-4-(pyridin-2-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridine-6-carboxamide;bis(2,2,2-trifluoroacetic acid).
| Compound Name | (3aR,6S,7aR)-N-pyrazin-2-yl-4-(pyridin-2-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridine-6-carboxamide;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155827427 |
| Molecular Formula | C22H23F6N5O6 |
| Molecular Weight | 567.44 g/mol |
| Exact Mass | 567.16 |
| IUPAC Name | (3aR,6S,7aR)-N-pyrazin-2-yl-4-(pyridin-2-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridine-6-carboxamide;bis(2,2,2-trifluoroacetic acid) |
| SMILES | O=C(Nc1cnccn1)[C@H]1C[C@H]2OCC[C@H]2N(Cc2ccccn2)C1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H21N5O2.2C2HF3O2/c24-18(22-17-10-19-6-7-21-17)13-9-16-15(4-8-25-16)23(11-13)12-14-3-1-2-5-20-14;2*3-2(4,5)1(6)7/h1-3,5-7,10,13,15-16H,4,8-9,11-12H2,(H,21,22,24);2*(H,6,7)/t13-,15+,16+;;/m0../s1 |
| InChIKey | YDLFQPMDQUHTID-IZQURSCRSA-N |
| XLogP | 2.76 |
| TPSA | 154.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.44 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |