C17H20F3N3O4S — CID 155835335
(3aR,6R,7aR)-6-(3-methyl-1,2,4-oxadiazol-5-yl)-4-(thiophen-2-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridine;2,2,2-trifluoroacetic acid (PubChem CID 155835335) has the molecular formula C17H20F3N3O4S and a molecular weight of 419.43 g/mol. Its IUPAC name is (3aR,6R,7aR)-6-(3-methyl-1,2,4-oxadiazol-5-yl)-4-(thiophen-2-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridine;2,2,2-trifluoroacetic acid.
| Compound Name | (3aR,6R,7aR)-6-(3-methyl-1,2,4-oxadiazol-5-yl)-4-(thiophen-2-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155835335 |
| Molecular Formula | C17H20F3N3O4S |
| Molecular Weight | 419.43 g/mol |
| Exact Mass | 419.11 |
| IUPAC Name | (3aR,6R,7aR)-6-(3-methyl-1,2,4-oxadiazol-5-yl)-4-(thiophen-2-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridine;2,2,2-trifluoroacetic acid |
| SMILES | Cc1noc([C@@H]2C[C@H]3OCC[C@H]3N(Cc3cccs3)C2)n1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H19N3O2S.C2HF3O2/c1-10-16-15(20-17-10)11-7-14-13(4-5-19-14)18(8-11)9-12-3-2-6-21-12;3-2(4,5)1(6)7/h2-3,6,11,13-14H,4-5,7-9H2,1H3;(H,6,7)/t11-,13-,14-;/m1./s1 |
| InChIKey | FFXXFNPNJIGLEI-JUDVJHIWSA-N |
| XLogP | 3.22 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.43 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |