C20H27F3N2O5 — CID 155846322
(3aR,6S,7aR)-4-[(4-methoxyphenyl)methyl]-N,N-dimethyl-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridine-6-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 155846322) has the molecular formula C20H27F3N2O5 and a molecular weight of 432.44 g/mol. Its IUPAC name is (3aR,6S,7aR)-4-[(4-methoxyphenyl)methyl]-N,N-dimethyl-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridine-6-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | (3aR,6S,7aR)-4-[(4-methoxyphenyl)methyl]-N,N-dimethyl-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridine-6-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155846322 |
| Molecular Formula | C20H27F3N2O5 |
| Molecular Weight | 432.44 g/mol |
| Exact Mass | 432.19 |
| IUPAC Name | (3aR,6S,7aR)-4-[(4-methoxyphenyl)methyl]-N,N-dimethyl-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridine-6-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | COc1ccc(CN2C[C@@H](C(=O)N(C)C)C[C@H]3OCC[C@H]32)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H26N2O3.C2HF3O2/c1-19(2)18(21)14-10-17-16(8-9-23-17)20(12-14)11-13-4-6-15(22-3)7-5-13;3-2(4,5)1(6)7/h4-7,14,16-17H,8-12H2,1-3H3;(H,6,7)/t14-,16+,17+;/m0./s1 |
| InChIKey | YPCWJOSIWWNODW-DYWKTHLTSA-N |
| XLogP | 2.40 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.44 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |