C22H29F3N2O5 — CID 155830202
(4aR,6S,7aR)-N-(cyclopropylmethyl)-4-[(4-methoxyphenyl)methyl]-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine-6-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 155830202) has the molecular formula C22H29F3N2O5 and a molecular weight of 458.48 g/mol. Its IUPAC name is (4aR,6S,7aR)-N-(cyclopropylmethyl)-4-[(4-methoxyphenyl)methyl]-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine-6-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | (4aR,6S,7aR)-N-(cyclopropylmethyl)-4-[(4-methoxyphenyl)methyl]-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine-6-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155830202 |
| Molecular Formula | C22H29F3N2O5 |
| Molecular Weight | 458.48 g/mol |
| Exact Mass | 458.20 |
| IUPAC Name | (4aR,6S,7aR)-N-(cyclopropylmethyl)-4-[(4-methoxyphenyl)methyl]-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine-6-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | COc1ccc(CN2CCO[C@@H]3C[C@@H](C(=O)NCC4CC4)C[C@H]32)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C20H28N2O3.C2HF3O2/c1-24-17-6-4-15(5-7-17)13-22-8-9-25-19-11-16(10-18(19)22)20(23)21-12-14-2-3-14;3-2(4,5)1(6)7/h4-7,14,16,18-19H,2-3,8-13H2,1H3,(H,21,23);(H,6,7)/t16-,18+,19+;/m0./s1 |
| InChIKey | GBERBPXKOFKKCW-MBHUSPCXSA-N |
| XLogP | 2.83 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.48 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |