C16H24N4O2 — CID 131682352
(3aR,6S,7aR)-N,N-dimethyl-4-[(6-methylpyrazin-2-yl)methyl]-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridine-6-carboxamide (PubChem CID 131682352) has the molecular formula C16H24N4O2 and a molecular weight of 304.39 g/mol. Its IUPAC name is (3aR,6S,7aR)-N,N-dimethyl-4-[(6-methylpyrazin-2-yl)methyl]-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridine-6-carboxamide.
| Compound Name | (3aR,6S,7aR)-N,N-dimethyl-4-[(6-methylpyrazin-2-yl)methyl]-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 131682352 |
| Molecular Formula | C16H24N4O2 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.19 |
| IUPAC Name | (3aR,6S,7aR)-N,N-dimethyl-4-[(6-methylpyrazin-2-yl)methyl]-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridine-6-carboxamide |
| SMILES | Cc1cncc(CN2C[C@@H](C(=O)N(C)C)C[C@H]3OCC[C@H]32)n1 |
| InChI | InChI=1S/C16H24N4O2/c1-11-7-17-8-13(18-11)10-20-9-12(16(21)19(2)3)6-15-14(20)4-5-22-15/h7-8,12,14-15H,4-6,9-10H2,1-3H3/t12-,14+,15+/m0/s1 |
| InChIKey | UPQQSNYWTLUSHS-NWANDNLSSA-N |
| XLogP | 0.85 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |