C22H24F4N2O5 — CID 155841804
(3aR,6S,7aR)-4-[(4-fluorophenyl)methyl]-N-(furan-2-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridine-6-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 155841804) has the molecular formula C22H24F4N2O5 and a molecular weight of 472.44 g/mol. Its IUPAC name is (3aR,6S,7aR)-4-[(4-fluorophenyl)methyl]-N-(furan-2-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridine-6-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | (3aR,6S,7aR)-4-[(4-fluorophenyl)methyl]-N-(furan-2-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridine-6-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155841804 |
| Molecular Formula | C22H24F4N2O5 |
| Molecular Weight | 472.44 g/mol |
| Exact Mass | 472.16 |
| IUPAC Name | (3aR,6S,7aR)-4-[(4-fluorophenyl)methyl]-N-(furan-2-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridine-6-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(NCc1ccco1)[C@H]1C[C@H]2OCC[C@H]2N(Cc2ccc(F)cc2)C1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C20H23FN2O3.C2HF3O2/c21-16-5-3-14(4-6-16)12-23-13-15(10-19-18(23)7-9-26-19)20(24)22-11-17-2-1-8-25-17;3-2(4,5)1(6)7/h1-6,8,15,18-19H,7,9-13H2,(H,22,24);(H,6,7)/t15-,18+,19+;/m0./s1 |
| InChIKey | RQPNZAUKZGVNBQ-GSDGHZPYSA-N |
| XLogP | 3.35 |
| TPSA | 92.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.44 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |