C18H22N2O4 — CID 97380410
(3aR,6S,7aR)-N,4-bis(furan-2-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridine-6-carboxamide (PubChem CID 97380410) has the molecular formula C18H22N2O4 and a molecular weight of 330.38 g/mol. Its IUPAC name is (3aR,6S,7aR)-N,4-bis(furan-2-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridine-6-carboxamide.
| Compound Name | (3aR,6S,7aR)-N,4-bis(furan-2-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 97380410 |
| Molecular Formula | C18H22N2O4 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | (3aR,6S,7aR)-N,4-bis(furan-2-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridine-6-carboxamide |
| SMILES | O=C(NCc1ccco1)[C@H]1C[C@H]2OCC[C@H]2N(Cc2ccco2)C1 |
| InChI | InChI=1S/C18H22N2O4/c21-18(19-10-14-3-1-6-22-14)13-9-17-16(5-8-24-17)20(11-13)12-15-4-2-7-23-15/h1-4,6-7,13,16-17H,5,8-12H2,(H,19,21)/t13-,16+,17+/m0/s1 |
| InChIKey | ONPKUAVRRYHURV-IAOVAPTHSA-N |
| XLogP | 2.17 |
| TPSA | 67.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |