C19H31N3O3 — CID 134689546
(3aS,6S,7aS)-4-[2-(diethylamino)ethyl]-N-(furan-2-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridine-6-carboxamide (PubChem CID 134689546) has the molecular formula C19H31N3O3 and a molecular weight of 349.48 g/mol. Its IUPAC name is (3aS,6S,7aS)-4-[2-(diethylamino)ethyl]-N-(furan-2-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridine-6-carboxamide.
| Compound Name | (3aS,6S,7aS)-4-[2-(diethylamino)ethyl]-N-(furan-2-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 134689546 |
| Molecular Formula | C19H31N3O3 |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.24 |
| IUPAC Name | (3aS,6S,7aS)-4-[2-(diethylamino)ethyl]-N-(furan-2-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridine-6-carboxamide |
| SMILES | CCN(CC)CCN1C[C@@H](C(=O)NCc2ccco2)C[C@@H]2OCC[C@@H]21 |
| InChI | InChI=1S/C19H31N3O3/c1-3-21(4-2)8-9-22-14-15(12-18-17(22)7-11-25-18)19(23)20-13-16-6-5-10-24-16/h5-6,10,15,17-18H,3-4,7-9,11-14H2,1-2H3,(H,20,23)/t15-,17-,18-/m0/s1 |
| InChIKey | TYKVDJMGVVRXSQ-SZMVWBNQSA-N |
| XLogP | 1.72 |
| TPSA | 57.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |