C19H21F4N3O4 — CID 127021458
(3aR,6S,7aR)-4-[(4-fluorophenyl)methyl]-6-(3-methyl-1,2,4-oxadiazol-5-yl)-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridine;2,2,2-trifluoroacetic acid (PubChem CID 127021458) has the molecular formula C19H21F4N3O4 and a molecular weight of 431.39 g/mol. Its IUPAC name is (3aR,6S,7aR)-4-[(4-fluorophenyl)methyl]-6-(3-methyl-1,2,4-oxadiazol-5-yl)-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridine;2,2,2-trifluoroacetic acid.
| Compound Name | (3aR,6S,7aR)-4-[(4-fluorophenyl)methyl]-6-(3-methyl-1,2,4-oxadiazol-5-yl)-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 127021458 |
| Molecular Formula | C19H21F4N3O4 |
| Molecular Weight | 431.39 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | (3aR,6S,7aR)-4-[(4-fluorophenyl)methyl]-6-(3-methyl-1,2,4-oxadiazol-5-yl)-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridine;2,2,2-trifluoroacetic acid |
| SMILES | Cc1noc([C@H]2C[C@H]3OCC[C@H]3N(Cc3ccc(F)cc3)C2)n1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H20FN3O2.C2HF3O2/c1-11-19-17(23-20-11)13-8-16-15(6-7-22-16)21(10-13)9-12-2-4-14(18)5-3-12;3-2(4,5)1(6)7/h2-5,13,15-16H,6-10H2,1H3;(H,6,7)/t13-,15+,16+;/m0./s1 |
| InChIKey | NCEOEDNTTYYKRB-QALYCTJVSA-N |
| XLogP | 3.30 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.39 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |