C21H27N3O3 — CID 97379074
N-[(3R,3aR,7aR)-1-[(4-methoxyphenyl)methyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-3-yl]-1-methylpyrrole-2-carboxamide (PubChem CID 97379074) has the molecular formula C21H27N3O3 and a molecular weight of 369.47 g/mol. Its IUPAC name is N-[(3R,3aR,7aR)-1-[(4-methoxyphenyl)methyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-3-yl]-1-methylpyrrole-2-carboxamide.
| Compound Name | N-[(3R,3aR,7aR)-1-[(4-methoxyphenyl)methyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-3-yl]-1-methylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 97379074 |
| Molecular Formula | C21H27N3O3 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.21 |
| IUPAC Name | N-[(3R,3aR,7aR)-1-[(4-methoxyphenyl)methyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-3-yl]-1-methylpyrrole-2-carboxamide |
| SMILES | COc1ccc(CN2C[C@@H](NC(=O)c3cccn3C)[C@H]3OCCC[C@H]32)cc1 |
| InChI | InChI=1S/C21H27N3O3/c1-23-11-3-5-19(23)21(25)22-17-14-24(18-6-4-12-27-20(17)18)13-15-7-9-16(26-2)10-8-15/h3,5,7-11,17-18,20H,4,6,12-14H2,1-2H3,(H,22,25)/t17-,18-,20-/m1/s1 |
| InChIKey | OOJLYLSWEXOAKH-QWFCFKBJSA-N |
| XLogP | 2.20 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |