C16H19N3O3S — CID 97387003
N-[(3R,3aR,7aR)-1-(furan-2-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-3-yl]-1,3-thiazole-4-carboxamide (PubChem CID 97387003) has the molecular formula C16H19N3O3S and a molecular weight of 333.41 g/mol. Its IUPAC name is N-[(3R,3aR,7aR)-1-(furan-2-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-3-yl]-1,3-thiazole-4-carboxamide.
| Compound Name | N-[(3R,3aR,7aR)-1-(furan-2-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-3-yl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 97387003 |
| Molecular Formula | C16H19N3O3S |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | N-[(3R,3aR,7aR)-1-(furan-2-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-3-yl]-1,3-thiazole-4-carboxamide |
| SMILES | O=C(N[C@@H]1CN(Cc2ccco2)[C@@H]2CCCO[C@@H]21)c1cscn1 |
| InChI | InChI=1S/C16H19N3O3S/c20-16(13-9-23-10-17-13)18-12-8-19(7-11-3-1-5-21-11)14-4-2-6-22-15(12)14/h1,3,5,9-10,12,14-15H,2,4,6-8H2,(H,18,20)/t12-,14-,15-/m1/s1 |
| InChIKey | ZZVHIOZJOBCUMA-BPLDGKMQSA-N |
| XLogP | 1.90 |
| TPSA | 67.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |